C24H21N3OS — CID 3135640
N-(2-methylphenyl)-2-(6-methyl-2-phenylquinazolin-4-yl)sulfanylacetamide (PubChem CID 3135640) has the molecular formula C24H21N3OS and a molecular weight of 399.52 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-(6-methyl-2-phenylquinazolin-4-yl)sulfanylacetamide.
| Compound Name | N-(2-methylphenyl)-2-(6-methyl-2-phenylquinazolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 3135640 |
| Molecular Formula | C24H21N3OS |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-(2-methylphenyl)-2-(6-methyl-2-phenylquinazolin-4-yl)sulfanylacetamide |
| SMILES | Cc1ccc2nc(-c3ccccc3)nc(SCC(=O)Nc3ccccc3C)c2c1 |
| InChI | InChI=1S/C24H21N3OS/c1-16-12-13-21-19(14-16)24(27-23(26-21)18-9-4-3-5-10-18)29-15-22(28)25-20-11-7-6-8-17(20)2/h3-14H,15H2,1-2H3,(H,25,28) |
| InChIKey | QEZUTQUGDZDOCE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |