C22H15BrClN3OS — CID 3136408
N-(2-bromophenyl)-2-(6-chloro-2-phenylquinazolin-4-yl)sulfanylacetamide (PubChem CID 3136408) has the molecular formula C22H15BrClN3OS and a molecular weight of 484.81 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(6-chloro-2-phenylquinazolin-4-yl)sulfanylacetamide.
| Compound Name | N-(2-bromophenyl)-2-(6-chloro-2-phenylquinazolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 3136408 |
| Molecular Formula | C22H15BrClN3OS |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 482.98 |
| IUPAC Name | N-(2-bromophenyl)-2-(6-chloro-2-phenylquinazolin-4-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)nc2ccc(Cl)cc12)Nc1ccccc1Br |
| InChI | InChI=1S/C22H15BrClN3OS/c23-17-8-4-5-9-19(17)25-20(28)13-29-22-16-12-15(24)10-11-18(16)26-21(27-22)14-6-2-1-3-7-14/h1-12H,13H2,(H,25,28) |
| InChIKey | IQYGSKRGSCJVOV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |