C23H17BrFN3O2S — CID 3137509
2-[2-(4-bromophenyl)-6-fluoroquinazolin-4-yl]sulfanyl-N-(2-methoxyphenyl)acetamide (PubChem CID 3137509) has the molecular formula C23H17BrFN3O2S and a molecular weight of 498.38 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)-6-fluoroquinazolin-4-yl]sulfanyl-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-(4-bromophenyl)-6-fluoroquinazolin-4-yl]sulfanyl-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3137509 |
| Molecular Formula | C23H17BrFN3O2S |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | 2-[2-(4-bromophenyl)-6-fluoroquinazolin-4-yl]sulfanyl-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CSc1nc(-c2ccc(Br)cc2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C23H17BrFN3O2S/c1-30-20-5-3-2-4-19(20)26-21(29)13-31-23-17-12-16(25)10-11-18(17)27-22(28-23)14-6-8-15(24)9-7-14/h2-12H,13H2,1H3,(H,26,29) |
| InChIKey | LJWNLANCXRZSNO-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |