C23H15BrFN5O4S — CID 3166979
N'-[2-[2-(4-bromophenyl)-6-fluoroquinazolin-4-yl]sulfanylacetyl]-2-nitrobenzohydrazide (PubChem CID 3166979) has the molecular formula C23H15BrFN5O4S and a molecular weight of 556.37 g/mol. Its IUPAC name is N'-[2-[2-(4-bromophenyl)-6-fluoroquinazolin-4-yl]sulfanylacetyl]-2-nitrobenzohydrazide.
| Compound Name | N'-[2-[2-(4-bromophenyl)-6-fluoroquinazolin-4-yl]sulfanylacetyl]-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 3166979 |
| Molecular Formula | C23H15BrFN5O4S |
| Molecular Weight | 556.37 g/mol |
| Exact Mass | 555.00 |
| IUPAC Name | N'-[2-[2-(4-bromophenyl)-6-fluoroquinazolin-4-yl]sulfanylacetyl]-2-nitrobenzohydrazide |
| SMILES | O=C(CSc1nc(-c2ccc(Br)cc2)nc2ccc(F)cc12)NNC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H15BrFN5O4S/c24-14-7-5-13(6-8-14)21-26-18-10-9-15(25)11-17(18)23(27-21)35-12-20(31)28-29-22(32)16-3-1-2-4-19(16)30(33)34/h1-11H,12H2,(H,28,31)(H,29,32) |
| InChIKey | GSBSIGTVOQYLTJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|