C25H22FN3OS — CID 3184944
N-benzyl-2-[6-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanylacetamide (PubChem CID 3184944) has the molecular formula C25H22FN3OS and a molecular weight of 431.54 g/mol. Its IUPAC name is N-benzyl-2-[6-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanylacetamide.
| Compound Name | N-benzyl-2-[6-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 3184944 |
| Molecular Formula | C25H22FN3OS |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-benzyl-2-[6-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanylacetamide |
| SMILES | CCc1ccc2nc(-c3ccc(F)cc3)nc(SCC(=O)NCc3ccccc3)c2c1 |
| InChI | InChI=1S/C25H22FN3OS/c1-2-17-8-13-22-21(14-17)25(29-24(28-22)19-9-11-20(26)12-10-19)31-16-23(30)27-15-18-6-4-3-5-7-18/h3-14H,2,15-16H2,1H3,(H,27,30) |
| InChIKey | YQUHCPUTHNDLCD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |