C26H22FN3O3S — CID 1136300
methyl 4-[[2-[6-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanylacetyl]amino]benzoate (PubChem CID 1136300) has the molecular formula C26H22FN3O3S and a molecular weight of 475.55 g/mol. Its IUPAC name is methyl 4-[[2-[6-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[6-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 1136300 |
| Molecular Formula | C26H22FN3O3S |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | methyl 4-[[2-[6-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanylacetyl]amino]benzoate |
| SMILES | CCc1ccc2nc(-c3ccc(F)cc3)nc(SCC(=O)Nc3ccc(C(=O)OC)cc3)c2c1 |
| InChI | InChI=1S/C26H22FN3O3S/c1-3-16-4-13-22-21(14-16)25(30-24(29-22)17-5-9-19(27)10-6-17)34-15-23(31)28-20-11-7-18(8-12-20)26(32)33-2/h4-14H,3,15H2,1-2H3,(H,28,31) |
| InChIKey | QIIZRXXRLZJYAY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |