C27H27N3O3S — CID 143900916
methyl 3-[[2-[6-ethyl-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]quinazolin-4-yl]sulfanylacetyl]amino]benzoate (PubChem CID 143900916) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is methyl 3-[[2-[6-ethyl-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]quinazolin-4-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-[6-ethyl-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]quinazolin-4-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 143900916 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | methyl 3-[[2-[6-ethyl-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]quinazolin-4-yl]sulfanylacetyl]amino]benzoate |
| SMILES | C=C/C=C\C(=C/C)c1nc(SCC(=O)Nc2cccc(C(=O)OC)c2)c2cc(CC)ccc2n1 |
| InChI | InChI=1S/C27H27N3O3S/c1-5-8-10-19(7-3)25-29-23-14-13-18(6-2)15-22(23)26(30-25)34-17-24(31)28-21-12-9-11-20(16-21)27(32)33-4/h5,7-16H,1,6,17H2,2-4H3,(H,28,31)/b10-8-,19-7+ |
| InChIKey | CGJKYDUCZURAEM-WPRXZDSASA-N |
| XLogP | 5.86 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|