C24H19ClFN3OS — CID 3166672
N-(4-chlorophenyl)-2-[6-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanylacetamide (PubChem CID 3166672) has the molecular formula C24H19ClFN3OS and a molecular weight of 451.95 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[6-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanylacetamide.
| Compound Name | N-(4-chlorophenyl)-2-[6-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 3166672 |
| Molecular Formula | C24H19ClFN3OS |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | N-(4-chlorophenyl)-2-[6-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanylacetamide |
| SMILES | CCc1ccc2nc(-c3ccc(F)cc3)nc(SCC(=O)Nc3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C24H19ClFN3OS/c1-2-15-3-12-21-20(13-15)24(29-23(28-21)16-4-8-18(26)9-5-16)31-14-22(30)27-19-10-6-17(25)7-11-19/h3-13H,2,14H2,1H3,(H,27,30) |
| InChIKey | OLBCTQMSLYCYFQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |