C24H17N7O4 — CID 135121639
N-(3-nitrophenyl)-2-[2-[4-(1,2,4-triazol-1-yl)phenyl]quinazolin-4-yl]oxyacetamide (PubChem CID 135121639) has the molecular formula C24H17N7O4 and a molecular weight of 467.45 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-[2-[4-(1,2,4-triazol-1-yl)phenyl]quinazolin-4-yl]oxyacetamide.
| Compound Name | N-(3-nitrophenyl)-2-[2-[4-(1,2,4-triazol-1-yl)phenyl]quinazolin-4-yl]oxyacetamide |
|---|---|
| PubChem CID | 135121639 |
| Molecular Formula | C24H17N7O4 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N-(3-nitrophenyl)-2-[2-[4-(1,2,4-triazol-1-yl)phenyl]quinazolin-4-yl]oxyacetamide |
| SMILES | O=C(COc1nc(-c2ccc(-n3cncn3)cc2)nc2ccccc12)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H17N7O4/c32-22(27-17-4-3-5-19(12-17)31(33)34)13-35-24-20-6-1-2-7-21(20)28-23(29-24)16-8-10-18(11-9-16)30-15-25-14-26-30/h1-12,14-15H,13H2,(H,27,32) |
| InChIKey | ZLEASKUMSUWFBZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|