C27H20N4O3S — CID 3127704
2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-nitrophenyl)propanamide (PubChem CID 3127704) has the molecular formula C27H20N4O3S and a molecular weight of 480.55 g/mol. Its IUPAC name is 2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-nitrophenyl)propanamide.
| Compound Name | 2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 3127704 |
| Molecular Formula | C27H20N4O3S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(3-nitrophenyl)propanamide |
| SMILES | CC(Sc1nc(-c2ccccc2)cc(-c2ccccc2)c1C#N)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H20N4O3S/c1-18(26(32)29-21-13-8-14-22(15-21)31(33)34)35-27-24(17-28)23(19-9-4-2-5-10-19)16-25(30-27)20-11-6-3-7-12-20/h2-16,18H,1H3,(H,29,32) |
| InChIKey | XAPSEPJQXRKDRM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|