C29H24ClN3O3S — CID 3165465
N-(3-chlorophenyl)-2-[[3-cyano-4,6-bis(4-methoxyphenyl)-2-pyridinyl]sulfanyl]propanamide (PubChem CID 3165465) has the molecular formula C29H24ClN3O3S and a molecular weight of 530.05 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[[3-cyano-4,6-bis(4-methoxyphenyl)-2-pyridinyl]sulfanyl]propanamide.
| Compound Name | N-(3-chlorophenyl)-2-[[3-cyano-4,6-bis(4-methoxyphenyl)-2-pyridinyl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 3165465 |
| Molecular Formula | C29H24ClN3O3S |
| Molecular Weight | 530.05 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | N-(3-chlorophenyl)-2-[[3-cyano-4,6-bis(4-methoxyphenyl)-2-pyridinyl]sulfanyl]propanamide |
| SMILES | COc1ccc(-c2cc(-c3ccc(OC)cc3)c(C#N)c(SC(C)C(=O)Nc3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C29H24ClN3O3S/c1-18(28(34)32-22-6-4-5-21(30)15-22)37-29-26(17-31)25(19-7-11-23(35-2)12-8-19)16-27(33-29)20-9-13-24(36-3)14-10-20/h4-16,18H,1-3H3,(H,32,34) |
| InChIKey | KZZCJZPIOBIJFO-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.05 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|