C30H27N3O2S — CID 40599045
(2R)-2-[[3-cyano-4-(4-methoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(2-methylphenyl)propanamide (PubChem CID 40599045) has the molecular formula C30H27N3O2S and a molecular weight of 493.63 g/mol. Its IUPAC name is (2R)-2-[[3-cyano-4-(4-methoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(2-methylphenyl)propanamide.
| Compound Name | (2R)-2-[[3-cyano-4-(4-methoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 40599045 |
| Molecular Formula | C30H27N3O2S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (2R)-2-[[3-cyano-4-(4-methoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(2-methylphenyl)propanamide |
| SMILES | COc1ccc(-c2cc(-c3ccc(C)cc3)nc(S[C@H](C)C(=O)Nc3ccccc3C)c2C#N)cc1 |
| InChI | InChI=1S/C30H27N3O2S/c1-19-9-11-23(12-10-19)28-17-25(22-13-15-24(35-4)16-14-22)26(18-31)30(33-28)36-21(3)29(34)32-27-8-6-5-7-20(27)2/h5-17,21H,1-4H3,(H,32,34)/t21-/m1/s1 |
| InChIKey | KMACNJOPWCDWJT-OAQYLSRUSA-N |
| XLogP | 7.03 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|