C33H27N5O4S2 — CID 25048922
2-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]propanamide (PubChem CID 25048922) has the molecular formula C33H27N5O4S2 and a molecular weight of 621.74 g/mol. Its IUPAC name is 2-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]propanamide.
| Compound Name | 2-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 25048922 |
| Molecular Formula | C33H27N5O4S2 |
| Molecular Weight | 621.74 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | 2-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]propanamide |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)nc(SC(C)C(=O)Nc3ccc(S(=O)(=O)Nc4ccccn4)cc3)c2C#N)cc1 |
| InChI | InChI=1S/C33H27N5O4S2/c1-22(32(39)36-25-13-17-27(18-14-25)44(40,41)38-31-10-6-7-19-35-31)43-33-29(21-34)28(23-11-15-26(42-2)16-12-23)20-30(37-33)24-8-4-3-5-9-24/h3-20,22H,1-2H3,(H,35,38)(H,36,39) |
| InChIKey | XHEYAABZXFONSB-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.74 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|