C32H30N4O7S2 — CID 25046357
N-[4-(acetylsulfamoyl)phenyl]-2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]propanamide (PubChem CID 25046357) has the molecular formula C32H30N4O7S2 and a molecular weight of 646.75 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]propanamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 25046357 |
| Molecular Formula | C32H30N4O7S2 |
| Molecular Weight | 646.75 g/mol |
| Exact Mass | 646.16 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]propanamide |
| SMILES | COc1cc(-c2cc(-c3ccccc3)nc(SC(C)C(=O)Nc3ccc(S(=O)(=O)NC(C)=O)cc3)c2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C32H30N4O7S2/c1-19(31(38)34-23-11-13-24(14-12-23)45(39,40)36-20(2)37)44-32-26(18-33)25(17-27(35-32)21-9-7-6-8-10-21)22-15-28(41-3)30(43-5)29(16-22)42-4/h6-17,19H,1-5H3,(H,34,38)(H,36,37) |
| InChIKey | FFNDJFOGZILGCP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 156.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.75 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|