C33H33N3O4S — CID 23998161
2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(3,5-dimethylphenyl)butanamide (PubChem CID 23998161) has the molecular formula C33H33N3O4S and a molecular weight of 567.71 g/mol. Its IUPAC name is 2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(3,5-dimethylphenyl)butanamide.
| Compound Name | 2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(3,5-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 23998161 |
| Molecular Formula | C33H33N3O4S |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(3,5-dimethylphenyl)butanamide |
| SMILES | CCC(Sc1nc(-c2ccccc2)cc(-c2cc(OC)c(OC)c(OC)c2)c1C#N)C(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C33H33N3O4S/c1-7-30(32(37)35-24-14-20(2)13-21(3)15-24)41-33-26(19-34)25(18-27(36-33)22-11-9-8-10-12-22)23-16-28(38-4)31(40-6)29(17-23)39-5/h8-18,30H,7H2,1-6H3,(H,35,37) |
| InChIKey | BJMGNQOMUKPSDB-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|