C24H22N2O3S — CID 53269903
2-[[3-cyano-6-(4-methoxyphenyl)-4-(4-methylphenyl)-2-pyridinyl]sulfanyl]butanoic acid (PubChem CID 53269903) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is 2-[[3-cyano-6-(4-methoxyphenyl)-4-(4-methylphenyl)-2-pyridinyl]sulfanyl]butanoic acid.
| Compound Name | 2-[[3-cyano-6-(4-methoxyphenyl)-4-(4-methylphenyl)-2-pyridinyl]sulfanyl]butanoic acid |
|---|---|
| PubChem CID | 53269903 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-[[3-cyano-6-(4-methoxyphenyl)-4-(4-methylphenyl)-2-pyridinyl]sulfanyl]butanoic acid |
| SMILES | CCC(Sc1nc(-c2ccc(OC)cc2)cc(-c2ccc(C)cc2)c1C#N)C(=O)O |
| InChI | InChI=1S/C24H22N2O3S/c1-4-22(24(27)28)30-23-20(14-25)19(16-7-5-15(2)6-8-16)13-21(26-23)17-9-11-18(29-3)12-10-17/h5-13,22H,4H2,1-3H3,(H,27,28) |
| InChIKey | ZBKOTYKGKZZUKG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |