C32H31N3O4S — CID 23886622
2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(3,4-dimethylphenyl)propanamide (PubChem CID 23886622) has the molecular formula C32H31N3O4S and a molecular weight of 553.68 g/mol. Its IUPAC name is 2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(3,4-dimethylphenyl)propanamide.
| Compound Name | 2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(3,4-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 23886622 |
| Molecular Formula | C32H31N3O4S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | 2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(3,4-dimethylphenyl)propanamide |
| SMILES | COc1cc(-c2cc(-c3ccccc3)nc(SC(C)C(=O)Nc3ccc(C)c(C)c3)c2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C32H31N3O4S/c1-19-12-13-24(14-20(19)2)34-31(36)21(3)40-32-26(18-33)25(17-27(35-32)22-10-8-7-9-11-22)23-15-28(37-4)30(39-6)29(16-23)38-5/h7-17,21H,1-6H3,(H,34,36) |
| InChIKey | HUOROLSVLFPDRH-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|