C31H30N4O4S — CID 23998211
2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(6-methyl-2-pyridinyl)butanamide (PubChem CID 23998211) has the molecular formula C31H30N4O4S and a molecular weight of 554.67 g/mol. Its IUPAC name is 2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(6-methyl-2-pyridinyl)butanamide.
| Compound Name | 2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(6-methyl-2-pyridinyl)butanamide |
|---|---|
| PubChem CID | 23998211 |
| Molecular Formula | C31H30N4O4S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(6-methyl-2-pyridinyl)butanamide |
| SMILES | CCC(Sc1nc(-c2ccccc2)cc(-c2cc(OC)c(OC)c(OC)c2)c1C#N)C(=O)Nc1cccc(C)n1 |
| InChI | InChI=1S/C31H30N4O4S/c1-6-27(30(36)35-28-14-10-11-19(2)33-28)40-31-23(18-32)22(17-24(34-31)20-12-8-7-9-13-20)21-15-25(37-3)29(39-5)26(16-21)38-4/h7-17,27H,6H2,1-5H3,(H,33,35,36) |
| InChIKey | WWHBVIKNXLBMBK-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|