C31H29N3O6S — CID 46497838
2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(2,5-dimethoxyphenyl)acetamide (PubChem CID 46497838) has the molecular formula C31H29N3O6S and a molecular weight of 571.66 g/mol. Its IUPAC name is 2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 46497838 |
| Molecular Formula | C31H29N3O6S |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)CSc2nc(-c3ccccc3)cc(-c3cc(OC)c(OC)c(OC)c3)c2C#N)c1 |
| InChI | InChI=1S/C31H29N3O6S/c1-36-21-11-12-26(37-2)25(15-21)33-29(35)18-41-31-23(17-32)22(16-24(34-31)19-9-7-6-8-10-19)20-13-27(38-3)30(40-5)28(14-20)39-4/h6-16H,18H2,1-5H3,(H,33,35) |
| InChIKey | IUFOEFKJEICSPV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 111.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|