C37H31N3O5S2 — CID 99679597
(2S)-2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenyl]propanamide (PubChem CID 99679597) has the molecular formula C37H31N3O5S2 and a molecular weight of 661.81 g/mol. Its IUPAC name is (2S)-2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenyl]propanamide.
| Compound Name | (2S)-2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 99679597 |
| Molecular Formula | C37H31N3O5S2 |
| Molecular Weight | 661.81 g/mol |
| Exact Mass | 661.17 |
| IUPAC Name | (2S)-2-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenyl]propanamide |
| SMILES | COc1cc(-c2cc(-c3ccccc3)nc(S[C@@H](C)C(=O)Nc3ccc(C(=O)/C=C/c4cccs4)cc3)c2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C37H31N3O5S2/c1-23(36(42)39-27-14-12-25(13-15-27)32(41)17-16-28-11-8-18-46-28)47-37-30(22-38)29(21-31(40-37)24-9-6-5-7-10-24)26-19-33(43-2)35(45-4)34(20-26)44-3/h5-21,23H,1-4H3,(H,39,42)/b17-16+/t23-/m0/s1 |
| InChIKey | FYCJCUJGGJFKAX-OFYULWLWSA-N |
| XLogP | 8.39 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.81 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|