C36H29N3O4S2 — CID 99679820
(2S)-2-[[3-cyano-4-(2,4-dimethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenyl]propanamide (PubChem CID 99679820) has the molecular formula C36H29N3O4S2 and a molecular weight of 631.78 g/mol. Its IUPAC name is (2S)-2-[[3-cyano-4-(2,4-dimethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenyl]propanamide.
| Compound Name | (2S)-2-[[3-cyano-4-(2,4-dimethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 99679820 |
| Molecular Formula | C36H29N3O4S2 |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.16 |
| IUPAC Name | (2S)-2-[[3-cyano-4-(2,4-dimethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenyl]propanamide |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)nc(S[C@@H](C)C(=O)Nc3ccc(C(=O)/C=C/c4cccs4)cc3)c2C#N)c(OC)c1 |
| InChI | InChI=1S/C36H29N3O4S2/c1-23(35(41)38-26-13-11-25(12-14-26)33(40)18-16-28-10-7-19-44-28)45-36-31(22-37)30(21-32(39-36)24-8-5-4-6-9-24)29-17-15-27(42-2)20-34(29)43-3/h4-21,23H,1-3H3,(H,38,41)/b18-16+/t23-/m0/s1 |
| InChIKey | NKMPSPUYGIJCJE-NGIFANIDSA-N |
| XLogP | 8.38 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|