C28H22N4O3S — CID 40601540
(2R)-2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(4-methyl-3-nitrophenyl)propanamide (PubChem CID 40601540) has the molecular formula C28H22N4O3S and a molecular weight of 494.58 g/mol. Its IUPAC name is (2R)-2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(4-methyl-3-nitrophenyl)propanamide.
| Compound Name | (2R)-2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(4-methyl-3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 40601540 |
| Molecular Formula | C28H22N4O3S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | (2R)-2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N-(4-methyl-3-nitrophenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)[C@@H](C)Sc2nc(-c3ccccc3)cc(-c3ccccc3)c2C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H22N4O3S/c1-18-13-14-22(15-26(18)32(34)35)30-27(33)19(2)36-28-24(17-29)23(20-9-5-3-6-10-20)16-25(31-28)21-11-7-4-8-12-21/h3-16,19H,1-2H3,(H,30,33)/t19-/m1/s1 |
| InChIKey | PFWVPHVQLXCMBZ-LJQANCHMSA-N |
| XLogP | 6.62 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|