C35H26F3N3O3S — CID 3165572
2-[[3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 3165572) has the molecular formula C35H26F3N3O3S and a molecular weight of 625.67 g/mol. Its IUPAC name is 2-[[3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3165572 |
| Molecular Formula | C35H26F3N3O3S |
| Molecular Weight | 625.67 g/mol |
| Exact Mass | 625.16 |
| IUPAC Name | 2-[[3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1cc(-c2cc(-c3ccccc3)nc(SCC(=O)Nc3ccccc3C(F)(F)F)c2C#N)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C35H26F3N3O3S/c1-43-32-18-25(16-17-31(32)44-21-23-10-4-2-5-11-23)26-19-30(24-12-6-3-7-13-24)41-34(27(26)20-39)45-22-33(42)40-29-15-9-8-14-28(29)35(36,37)38/h2-19H,21-22H2,1H3,(H,40,42) |
| InChIKey | CNQNIBYYPJTLRS-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.67 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|