C19H13ClN2O2S2 — CID 1035693
methyl 2-[[4-(4-chlorophenyl)-3-cyano-6-thiophen-2-yl-2-pyridinyl]sulfanyl]acetate (PubChem CID 1035693) has the molecular formula C19H13ClN2O2S2 and a molecular weight of 400.91 g/mol. Its IUPAC name is methyl 2-[[4-(4-chlorophenyl)-3-cyano-6-thiophen-2-yl-2-pyridinyl]sulfanyl]acetate.
| Compound Name | methyl 2-[[4-(4-chlorophenyl)-3-cyano-6-thiophen-2-yl-2-pyridinyl]sulfanyl]acetate |
|---|---|
| PubChem CID | 1035693 |
| Molecular Formula | C19H13ClN2O2S2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | methyl 2-[[4-(4-chlorophenyl)-3-cyano-6-thiophen-2-yl-2-pyridinyl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nc(-c2cccs2)cc(-c2ccc(Cl)cc2)c1C#N |
| InChI | InChI=1S/C19H13ClN2O2S2/c1-24-18(23)11-26-19-15(10-21)14(12-4-6-13(20)7-5-12)9-16(22-19)17-3-2-8-25-17/h2-9H,11H2,1H3 |
| InChIKey | GAOZAEGXMCEYEF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |