C23H15ClN2S2 — CID 4022523
2-benzylsulfanyl-4-(4-chlorophenyl)-6-thiophen-2-ylpyridine-3-carbonitrile (PubChem CID 4022523) has the molecular formula C23H15ClN2S2 and a molecular weight of 418.97 g/mol. Its IUPAC name is 2-benzylsulfanyl-4-(4-chlorophenyl)-6-thiophen-2-ylpyridine-3-carbonitrile.
| Compound Name | 2-benzylsulfanyl-4-(4-chlorophenyl)-6-thiophen-2-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 4022523 |
| Molecular Formula | C23H15ClN2S2 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 2-benzylsulfanyl-4-(4-chlorophenyl)-6-thiophen-2-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)cc(-c2cccs2)nc1SCc1ccccc1 |
| InChI | InChI=1S/C23H15ClN2S2/c24-18-10-8-17(9-11-18)19-13-21(22-7-4-12-27-22)26-23(20(19)14-25)28-15-16-5-2-1-3-6-16/h1-13H,15H2 |
| InChIKey | NSHLUHSMOFGPBR-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |