C23H15ClN2OS2 — CID 40945006
2-[(R)-(4-chlorophenyl)methylsulfinyl]-4-phenyl-6-thiophen-2-ylpyridine-3-carbonitrile (PubChem CID 40945006) has the molecular formula C23H15ClN2OS2 and a molecular weight of 434.97 g/mol. Its IUPAC name is 2-[(R)-(4-chlorophenyl)methylsulfinyl]-4-phenyl-6-thiophen-2-ylpyridine-3-carbonitrile.
| Compound Name | 2-[(R)-(4-chlorophenyl)methylsulfinyl]-4-phenyl-6-thiophen-2-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 40945006 |
| Molecular Formula | C23H15ClN2OS2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 2-[(R)-(4-chlorophenyl)methylsulfinyl]-4-phenyl-6-thiophen-2-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)cc(-c2cccs2)nc1[S@](=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H15ClN2OS2/c24-18-10-8-16(9-11-18)15-29(27)23-20(14-25)19(17-5-2-1-3-6-17)13-21(26-23)22-7-4-12-28-22/h1-13H,15H2/t29-/m1/s1 |
| InChIKey | LKSDEUWISFYTBY-GDLZYMKVSA-N |
| XLogP | 6.31 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |