C26H20N2O3S — CID 143568553
ethyl 2-[(3-cyano-4-phenyl-6-thiophen-2-yl-2-pyridinyl)oxy]-2-phenylacetate (PubChem CID 143568553) has the molecular formula C26H20N2O3S and a molecular weight of 440.52 g/mol. Its IUPAC name is ethyl 2-[(3-cyano-4-phenyl-6-thiophen-2-yl-2-pyridinyl)oxy]-2-phenylacetate.
| Compound Name | ethyl 2-[(3-cyano-4-phenyl-6-thiophen-2-yl-2-pyridinyl)oxy]-2-phenylacetate |
|---|---|
| PubChem CID | 143568553 |
| Molecular Formula | C26H20N2O3S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | ethyl 2-[(3-cyano-4-phenyl-6-thiophen-2-yl-2-pyridinyl)oxy]-2-phenylacetate |
| SMILES | CCOC(=O)C(Oc1nc(-c2cccs2)cc(-c2ccccc2)c1C#N)c1ccccc1 |
| InChI | InChI=1S/C26H20N2O3S/c1-2-30-26(29)24(19-12-7-4-8-13-19)31-25-21(17-27)20(18-10-5-3-6-11-18)16-22(28-25)23-14-9-15-32-23/h3-16,24H,2H2,1H3 |
| InChIKey | DHUXNAYBPXXXMV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |