C22H18N6OS2 — CID 143568436
2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide (PubChem CID 143568436) has the molecular formula C22H18N6OS2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide.
| Compound Name | 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide |
|---|---|
| PubChem CID | 143568436 |
| Molecular Formula | C22H18N6OS2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide |
| SMILES | N#Cc1c(-c2cccs2)cc(-c2cccs2)nc1OC(/C(N)=N/NN)c1ccccc1 |
| InChI | InChI=1S/C22H18N6OS2/c23-13-16-15(18-8-4-10-30-18)12-17(19-9-5-11-31-19)26-22(16)29-20(21(24)27-28-25)14-6-2-1-3-7-14/h1-12,20,28H,25H2,(H2,24,27) |
| InChIKey | UTUJDUJGLWVQTI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|