About 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide
2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide (PubChem CID 143568436) has the molecular formula C22H18N6OS2
and a molecular weight of 446.56 g/mol. Its IUPAC name is 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide.
Molecular Properties
| Compound Name | 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide |
| PubChem CID | 143568436 |
| Molecular Formula | C22H18N6OS2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide |
| SMILES | N#Cc1c(-c2cccs2)cc(-c2cccs2)nc1OC(/C(N)=N/NN)c1ccccc1 |
| InChI | InChI=1S/C22H18N6OS2/c23-13-16-15(18-8-4-10-30-18)12-17(19-9-5-11-31-19)26-22(16)29-20(21(24)27-28-25)14-6-2-1-3-7-14/h1-12,20,28H,25H2,(H2,24,27) |
| InChIKey | UTUJDUJGLWVQTI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide?
The IUPAC name of 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide (CID 143568436) is 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide.
What is the SMILES notation for 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide?
The canonical SMILES for 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide is N#Cc1c(-c2cccs2)cc(-c2cccs2)nc1OC(/C(N)=N/NN)c1ccccc1.
What is the InChIKey of 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide?
The InChIKey is UTUJDUJGLWVQTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N6OS2/c23-13-16-15(18-8-4-10-30-18)12-17(19-9-5-11-31-19)26-22(16)29-20(21(24)27-28-25)14-6-2-1-3-7-14/h1-12,20,28H,25H2,(H2,24,27).
What are the key properties of 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide?
2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide has a molecular weight of 446.56 g/mol, XLogP of 4.27, 7 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-cyano-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-N'-hydrazinyl-2-phenylethanimidamide is sourced from PubChem (CID 143568436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).