C24H20N6O3S — CID 143568425
N-[(E)-C-aminocarbonohydrazonoyl]-2-[[3-cyano-4-(4H-pyran-3-yl)-6-thiophen-2-yl-2-pyridinyl]oxy]-2-phenylacetamide (PubChem CID 143568425) has the molecular formula C24H20N6O3S and a molecular weight of 472.53 g/mol. Its IUPAC name is N-[(E)-C-aminocarbonohydrazonoyl]-2-[[3-cyano-4-(4H-pyran-3-yl)-6-thiophen-2-yl-2-pyridinyl]oxy]-2-phenylacetamide.
| Compound Name | N-[(E)-C-aminocarbonohydrazonoyl]-2-[[3-cyano-4-(4H-pyran-3-yl)-6-thiophen-2-yl-2-pyridinyl]oxy]-2-phenylacetamide |
|---|---|
| PubChem CID | 143568425 |
| Molecular Formula | C24H20N6O3S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | N-[(E)-C-aminocarbonohydrazonoyl]-2-[[3-cyano-4-(4H-pyran-3-yl)-6-thiophen-2-yl-2-pyridinyl]oxy]-2-phenylacetamide |
| SMILES | N#Cc1c(C2=COC=CC2)cc(-c2cccs2)nc1OC(C(=O)N/C(N)=N/N)c1ccccc1 |
| InChI | InChI=1S/C24H20N6O3S/c25-13-18-17(16-8-4-10-32-14-16)12-19(20-9-5-11-34-20)28-23(18)33-21(15-6-2-1-3-7-15)22(31)29-24(26)30-27/h1-7,9-12,14,21H,8,27H2,(H3,26,29,30,31) |
| InChIKey | UUAUZHNFZLEIBW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|