C21H16N2O3S2 — CID 71157282
2-[(3-amino-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-2-phenylacetic acid (PubChem CID 71157282) has the molecular formula C21H16N2O3S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-[(3-amino-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-2-phenylacetic acid.
| Compound Name | 2-[(3-amino-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-2-phenylacetic acid |
|---|---|
| PubChem CID | 71157282 |
| Molecular Formula | C21H16N2O3S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-[(3-amino-4,6-dithiophen-2-yl-2-pyridinyl)oxy]-2-phenylacetic acid |
| SMILES | Nc1c(-c2cccs2)cc(-c2cccs2)nc1OC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C21H16N2O3S2/c22-18-14(16-8-4-10-27-16)12-15(17-9-5-11-28-17)23-20(18)26-19(21(24)25)13-6-2-1-3-7-13/h1-12,19H,22H2,(H,24,25) |
| InChIKey | MEALXNNMTXCUCZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |