C21H17ClN2O2S2 — CID 5120735
propan-2-yl 2-[[4-(4-chlorophenyl)-3-cyano-6-thiophen-2-yl-2-pyridinyl]sulfanyl]acetate (PubChem CID 5120735) has the molecular formula C21H17ClN2O2S2 and a molecular weight of 428.97 g/mol. Its IUPAC name is propan-2-yl 2-[[4-(4-chlorophenyl)-3-cyano-6-thiophen-2-yl-2-pyridinyl]sulfanyl]acetate.
| Compound Name | propan-2-yl 2-[[4-(4-chlorophenyl)-3-cyano-6-thiophen-2-yl-2-pyridinyl]sulfanyl]acetate |
|---|---|
| PubChem CID | 5120735 |
| Molecular Formula | C21H17ClN2O2S2 |
| Molecular Weight | 428.97 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | propan-2-yl 2-[[4-(4-chlorophenyl)-3-cyano-6-thiophen-2-yl-2-pyridinyl]sulfanyl]acetate |
| SMILES | CC(C)OC(=O)CSc1nc(-c2cccs2)cc(-c2ccc(Cl)cc2)c1C#N |
| InChI | InChI=1S/C21H17ClN2O2S2/c1-13(2)26-20(25)12-28-21-17(11-23)16(14-5-7-15(22)8-6-14)10-18(24-21)19-4-3-9-27-19/h3-10,13H,12H2,1-2H3 |
| InChIKey | SAEKQWNOHWTLFS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.97 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |