C22H19ClN2O5S2 — CID 102128445
4-(4-chlorophenyl)-6-thiophen-2-yl-2-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpyridine-3-carbonitrile (PubChem CID 102128445) has the molecular formula C22H19ClN2O5S2 and a molecular weight of 490.99 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-6-thiophen-2-yl-2-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpyridine-3-carbonitrile.
| Compound Name | 4-(4-chlorophenyl)-6-thiophen-2-yl-2-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 102128445 |
| Molecular Formula | C22H19ClN2O5S2 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | 4-(4-chlorophenyl)-6-thiophen-2-yl-2-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)cc(-c2cccs2)nc1S[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H19ClN2O5S2/c23-12-5-3-11(4-6-12)13-8-15(17-2-1-7-31-17)25-21(14(13)9-24)32-22-20(29)19(28)18(27)16(10-26)30-22/h1-8,16,18-20,22,26-29H,10H2/t16-,18+,19+,20-,22+/m1/s1 |
| InChIKey | FPEFXHGPBJZFOJ-QQRBNAFBSA-N |
| XLogP | 2.89 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |