C20H18ClN2OS2Si — CID 145153614
CID 145153614 (PubChem CID 145153614) has the molecular formula C20H18ClN2OS2Si and a molecular weight of 430.05 g/mol.
| Compound Name | CID 145153614 |
|---|---|
| PubChem CID | 145153614 |
| Molecular Formula | C20H18ClN2OS2Si |
| Molecular Weight | 430.05 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | — |
| SMILES | N#Cc1c(-c2ccccc2)cc(-c2cccs2)nc1SC[Si](O)CCCCl |
| InChI | InChI=1S/C20H18ClN2OS2Si/c21-9-5-11-27(24)14-26-20-17(13-22)16(15-6-2-1-3-7-15)12-18(23-20)19-8-4-10-25-19/h1-4,6-8,10,12,24H,5,9,11,14H2 |
| InChIKey | IPHKVWCPSFUIAM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.05 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|