C15H14N2O2S2 — CID 690947
ethyl (2R)-2-[(3-cyano-6-thiophen-2-yl-2-pyridinyl)sulfanyl]propanoate (PubChem CID 690947) has the molecular formula C15H14N2O2S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is ethyl (2R)-2-[(3-cyano-6-thiophen-2-yl-2-pyridinyl)sulfanyl]propanoate.
| Compound Name | ethyl (2R)-2-[(3-cyano-6-thiophen-2-yl-2-pyridinyl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 690947 |
| Molecular Formula | C15H14N2O2S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | ethyl (2R)-2-[(3-cyano-6-thiophen-2-yl-2-pyridinyl)sulfanyl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Sc1nc(-c2cccs2)ccc1C#N |
| InChI | InChI=1S/C15H14N2O2S2/c1-3-19-15(18)10(2)21-14-11(9-16)6-7-12(17-14)13-5-4-8-20-13/h4-8,10H,3H2,1-2H3/t10-/m1/s1 |
| InChIKey | XDPNYRKNALIZHU-SNVBAGLBSA-N |
| XLogP | 3.73 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |