C17H13F3N2O3S2 — CID 1282692
ethyl (2R)-2-[[3-cyano-6-thiophen-2-yl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-3-oxobutanoate (PubChem CID 1282692) has the molecular formula C17H13F3N2O3S2 and a molecular weight of 414.43 g/mol. Its IUPAC name is ethyl (2R)-2-[[3-cyano-6-thiophen-2-yl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl (2R)-2-[[3-cyano-6-thiophen-2-yl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 1282692 |
| Molecular Formula | C17H13F3N2O3S2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | ethyl (2R)-2-[[3-cyano-6-thiophen-2-yl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)[C@H](Sc1nc(-c2cccs2)cc(C(F)(F)F)c1C#N)C(C)=O |
| InChI | InChI=1S/C17H13F3N2O3S2/c1-3-25-16(24)14(9(2)23)27-15-10(8-21)11(17(18,19)20)7-12(22-15)13-5-4-6-26-13/h4-7,14H,3H2,1-2H3/t14-/m1/s1 |
| InChIKey | TVVPUJNOJXICNT-CQSZACIVSA-N |
| XLogP | 4.31 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|