C12H7F3N2S — CID 15325355
2-methyl-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 15325355) has the molecular formula C12H7F3N2S and a molecular weight of 268.26 g/mol. Its IUPAC name is 2-methyl-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-methyl-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 15325355 |
| Molecular Formula | C12H7F3N2S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-methyl-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | Cc1nc(-c2cccs2)cc(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C12H7F3N2S/c1-7-8(6-16)9(12(13,14)15)5-10(17-7)11-3-2-4-18-11/h2-5H,1H3 |
| InChIKey | JCQOKWZBMSVMHP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |