C17H10F3N3S2 — CID 2726264
2-(2-aminophenyl)sulfanyl-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 2726264) has the molecular formula C17H10F3N3S2 and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-(2-aminophenyl)sulfanyl-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-(2-aminophenyl)sulfanyl-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 2726264 |
| Molecular Formula | C17H10F3N3S2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 2-(2-aminophenyl)sulfanyl-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(C(F)(F)F)cc(-c2cccs2)nc1Sc1ccccc1N |
| InChI | InChI=1S/C17H10F3N3S2/c18-17(19,20)11-8-13(15-6-3-7-24-15)23-16(10(11)9-21)25-14-5-2-1-4-12(14)22/h1-8H,22H2 |
| InChIKey | LREDPBINCUVJGY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|