C17H13F3N2OS2 — CID 2942865
2-(2-oxocyclohexyl)sulfanyl-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 2942865) has the molecular formula C17H13F3N2OS2 and a molecular weight of 382.43 g/mol. Its IUPAC name is 2-(2-oxocyclohexyl)sulfanyl-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-(2-oxocyclohexyl)sulfanyl-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 2942865 |
| Molecular Formula | C17H13F3N2OS2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2-(2-oxocyclohexyl)sulfanyl-6-thiophen-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(C(F)(F)F)cc(-c2cccs2)nc1SC1CCCCC1=O |
| InChI | InChI=1S/C17H13F3N2OS2/c18-17(19,20)11-8-12(14-6-3-7-24-14)22-16(10(11)9-21)25-15-5-2-1-4-13(15)23/h3,6-8,15H,1-2,4-5H2 |
| InChIKey | CMJALZODBFVTKZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |