About ethane;propane;2-thiophen-2-ylpyrazine
ethane;propane;2-thiophen-2-ylpyrazine (PubChem CID 142831454) has the molecular formula C13H20N2S
and a molecular weight of 236.38 g/mol. Its IUPAC name is ethane;propane;2-thiophen-2-ylpyrazine.
Molecular Properties
| Compound Name | ethane;propane;2-thiophen-2-ylpyrazine |
| PubChem CID | 142831454 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | ethane;propane;2-thiophen-2-ylpyrazine |
| SMILES | CC.CCC.c1csc(-c2cnccn2)c1 |
| InChI | InChI=1S/C8H6N2S.C3H8.C2H6/c1-2-8(11-5-1)7-6-9-3-4-10-7;1-3-2;1-2/h1-6H;3H2,1-2H3;1-2H3 |
| InChIKey | UYRUSSIZFPNRBN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;propane;2-thiophen-2-ylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propane;2-thiophen-2-ylpyrazine?
The IUPAC name of ethane;propane;2-thiophen-2-ylpyrazine (CID 142831454) is ethane;propane;2-thiophen-2-ylpyrazine.
What is the SMILES notation for ethane;propane;2-thiophen-2-ylpyrazine?
The canonical SMILES for ethane;propane;2-thiophen-2-ylpyrazine is CC.CCC.c1csc(-c2cnccn2)c1.
What is the InChIKey of ethane;propane;2-thiophen-2-ylpyrazine?
The InChIKey is UYRUSSIZFPNRBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2S.C3H8.C2H6/c1-2-8(11-5-1)7-6-9-3-4-10-7;1-3-2;1-2/h1-6H;3H2,1-2H3;1-2H3.
What are the key properties of ethane;propane;2-thiophen-2-ylpyrazine?
ethane;propane;2-thiophen-2-ylpyrazine has a molecular weight of 236.38 g/mol, XLogP of 4.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propane;2-thiophen-2-ylpyrazine is sourced from PubChem (CID 142831454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).