C8H7N3S — CID 135139824
3-methyl-6-thiophen-2-yl-1,2,4-triazine (PubChem CID 135139824) has the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. Its IUPAC name is 3-methyl-6-thiophen-2-yl-1,2,4-triazine.
| Compound Name | 3-methyl-6-thiophen-2-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 135139824 |
| Molecular Formula | C8H7N3S |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 3-methyl-6-thiophen-2-yl-1,2,4-triazine |
| SMILES | Cc1ncc(-c2cccs2)nn1 |
| InChI | InChI=1S/C8H7N3S/c1-6-9-5-7(11-10-6)8-3-2-4-12-8/h2-5H,1H3 |
| InChIKey | MCBZOSRYKWECTG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |