C13H7F3N2O2S2 — CID 627201
2-[[3-cyano-4-thiophen-2-yl-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid (PubChem CID 627201) has the molecular formula C13H7F3N2O2S2 and a molecular weight of 344.34 g/mol. Its IUPAC name is 2-[[3-cyano-4-thiophen-2-yl-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid.
| Compound Name | 2-[[3-cyano-4-thiophen-2-yl-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 627201 |
| Molecular Formula | C13H7F3N2O2S2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 2-[[3-cyano-4-thiophen-2-yl-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid |
| SMILES | N#Cc1c(-c2cccs2)cc(C(F)(F)F)nc1SCC(=O)O |
| InChI | InChI=1S/C13H7F3N2O2S2/c14-13(15,16)10-4-7(9-2-1-3-21-9)8(5-17)12(18-10)22-6-11(19)20/h1-4H,6H2,(H,19,20) |
| InChIKey | FEQDIZNRMFFYJZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |