C21H16F3N3 — CID 3400568
2-amino-5-ethyl-6-phenyl-4-[3-(trifluoromethyl)phenyl]pyridine-3-carbonitrile (PubChem CID 3400568) has the molecular formula C21H16F3N3 and a molecular weight of 367.37 g/mol. Its IUPAC name is 2-amino-5-ethyl-6-phenyl-4-[3-(trifluoromethyl)phenyl]pyridine-3-carbonitrile.
| Compound Name | 2-amino-5-ethyl-6-phenyl-4-[3-(trifluoromethyl)phenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3400568 |
| Molecular Formula | C21H16F3N3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-amino-5-ethyl-6-phenyl-4-[3-(trifluoromethyl)phenyl]pyridine-3-carbonitrile |
| SMILES | CCc1c(-c2ccccc2)nc(N)c(C#N)c1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H16F3N3/c1-2-16-18(14-9-6-10-15(11-14)21(22,23)24)17(12-25)20(26)27-19(16)13-7-4-3-5-8-13/h3-11H,2H2,1H3,(H2,26,27) |
| InChIKey | ZSTLVALPSKQJID-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |