C15H16N8 — CID 170452769
7-amino-5-(butylamino)-2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile (PubChem CID 170452769) has the molecular formula C15H16N8 and a molecular weight of 308.35 g/mol. Its IUPAC name is 7-amino-5-(butylamino)-2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile.
| Compound Name | 7-amino-5-(butylamino)-2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 170452769 |
| Molecular Formula | C15H16N8 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 7-amino-5-(butylamino)-2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile |
| SMILES | CCCCNc1nc2nc(-c3cccnc3)nn2c(N)c1C#N |
| InChI | InChI=1S/C15H16N8/c1-2-3-7-19-14-11(8-16)12(17)23-15(21-14)20-13(22-23)10-5-4-6-18-9-10/h4-6,9H,2-3,7,17H2,1H3,(H,19,20,21,22) |
| InChIKey | QLKRRHBCLIOAOU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|