C19H20N6S2 — CID 135387944
4-(butylsulfanylmethylsulfanyl)-6-(1-methylimidazol-4-yl)-2-pyridin-3-ylpyrimidine-5-carbonitrile (PubChem CID 135387944) has the molecular formula C19H20N6S2 and a molecular weight of 396.55 g/mol. Its IUPAC name is 4-(butylsulfanylmethylsulfanyl)-6-(1-methylimidazol-4-yl)-2-pyridin-3-ylpyrimidine-5-carbonitrile.
| Compound Name | 4-(butylsulfanylmethylsulfanyl)-6-(1-methylimidazol-4-yl)-2-pyridin-3-ylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135387944 |
| Molecular Formula | C19H20N6S2 |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 4-(butylsulfanylmethylsulfanyl)-6-(1-methylimidazol-4-yl)-2-pyridin-3-ylpyrimidine-5-carbonitrile |
| SMILES | CCCCSCSc1nc(-c2cccnc2)nc(-c2cn(C)cn2)c1C#N |
| InChI | InChI=1S/C19H20N6S2/c1-3-4-8-26-13-27-19-15(9-20)17(16-11-25(2)12-22-16)23-18(24-19)14-6-5-7-21-10-14/h5-7,10-12H,3-4,8,13H2,1-2H3 |
| InChIKey | BRFWAVJRXFRQRO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|