About N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine
N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine (PubChem CID 59340680) has the molecular formula C15H20N4
and a molecular weight of 256.35 g/mol. Its IUPAC name is N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine |
| PubChem CID | 59340680 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine |
| SMILES | CCCCN(C)c1cc(C)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C15H20N4/c1-4-5-9-19(3)14-10-12(2)17-15(18-14)13-7-6-8-16-11-13/h6-8,10-11H,4-5,9H2,1-3H3 |
| InChIKey | BFHNYUNZHQNYMJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine?
The IUPAC name of N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine (CID 59340680) is N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine.
What is the SMILES notation for N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine?
The canonical SMILES for N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine is CCCCN(C)c1cc(C)nc(-c2cccnc2)n1.
What is the InChIKey of N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine?
The InChIKey is BFHNYUNZHQNYMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4/c1-4-5-9-19(3)14-10-12(2)17-15(18-14)13-7-6-8-16-11-13/h6-8,10-11H,4-5,9H2,1-3H3.
What are the key properties of N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine?
N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine has a molecular weight of 256.35 g/mol, XLogP of 3.08, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N,6-dimethyl-2-pyridin-3-ylpyrimidin-4-amine is sourced from PubChem (CID 59340680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).