C11H15N7 — CID 170452748
7-amino-5-(butylamino)-2-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile (PubChem CID 170452748) has the molecular formula C11H15N7 and a molecular weight of 245.29 g/mol. Its IUPAC name is 7-amino-5-(butylamino)-2-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile.
| Compound Name | 7-amino-5-(butylamino)-2-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 170452748 |
| Molecular Formula | C11H15N7 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 7-amino-5-(butylamino)-2-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile |
| SMILES | CCCCNc1nc2nc(C)nn2c(N)c1C#N |
| InChI | InChI=1S/C11H15N7/c1-3-4-5-14-10-8(6-12)9(13)18-11(16-10)15-7(2)17-18/h3-5,13H2,1-2H3,(H,14,15,16,17) |
| InChIKey | YUZZSVMKNJZWOC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|