C11H14N4S — CID 103425366
3-amino-5-(pentylamino)thiophene-2,4-dicarbonitrile (PubChem CID 103425366) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 3-amino-5-(pentylamino)thiophene-2,4-dicarbonitrile.
| Compound Name | 3-amino-5-(pentylamino)thiophene-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 103425366 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-amino-5-(pentylamino)thiophene-2,4-dicarbonitrile |
| SMILES | CCCCCNc1sc(C#N)c(N)c1C#N |
| InChI | InChI=1S/C11H14N4S/c1-2-3-4-5-15-11-8(6-12)10(14)9(7-13)16-11/h15H,2-5,14H2,1H3 |
| InChIKey | UGPXTYXNVSSVEJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|