C12H19N3OS2 — CID 114132062
3-amino-5-(5-methoxypentylamino)-4-methylsulfanylthiophene-2-carbonitrile (PubChem CID 114132062) has the molecular formula C12H19N3OS2 and a molecular weight of 285.44 g/mol. Its IUPAC name is 3-amino-5-(5-methoxypentylamino)-4-methylsulfanylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-(5-methoxypentylamino)-4-methylsulfanylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 114132062 |
| Molecular Formula | C12H19N3OS2 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-amino-5-(5-methoxypentylamino)-4-methylsulfanylthiophene-2-carbonitrile |
| SMILES | COCCCCCNc1sc(C#N)c(N)c1SC |
| InChI | InChI=1S/C12H19N3OS2/c1-16-7-5-3-4-6-15-12-11(17-2)10(14)9(8-13)18-12/h15H,3-7,14H2,1-2H3 |
| InChIKey | FZTWWSLREYZLGJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|