C10H15N3OS2 — CID 103428094
3-amino-5-(2-ethoxyethylamino)-4-methylsulfanylthiophene-2-carbonitrile (PubChem CID 103428094) has the molecular formula C10H15N3OS2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 3-amino-5-(2-ethoxyethylamino)-4-methylsulfanylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-(2-ethoxyethylamino)-4-methylsulfanylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103428094 |
| Molecular Formula | C10H15N3OS2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-amino-5-(2-ethoxyethylamino)-4-methylsulfanylthiophene-2-carbonitrile |
| SMILES | CCOCCNc1sc(C#N)c(N)c1SC |
| InChI | InChI=1S/C10H15N3OS2/c1-3-14-5-4-13-10-9(15-2)8(12)7(6-11)16-10/h13H,3-5,12H2,1-2H3 |
| InChIKey | DETAFQGEEWVFJE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|