C13H14N4S2 — CID 103427506
3-amino-4-methylsulfanyl-5-(1-pyridin-4-ylethylamino)thiophene-2-carbonitrile (PubChem CID 103427506) has the molecular formula C13H14N4S2 and a molecular weight of 290.42 g/mol. Its IUPAC name is 3-amino-4-methylsulfanyl-5-(1-pyridin-4-ylethylamino)thiophene-2-carbonitrile.
| Compound Name | 3-amino-4-methylsulfanyl-5-(1-pyridin-4-ylethylamino)thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103427506 |
| Molecular Formula | C13H14N4S2 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-amino-4-methylsulfanyl-5-(1-pyridin-4-ylethylamino)thiophene-2-carbonitrile |
| SMILES | CSc1c(NC(C)c2ccncc2)sc(C#N)c1N |
| InChI | InChI=1S/C13H14N4S2/c1-8(9-3-5-16-6-4-9)17-13-12(18-2)11(15)10(7-14)19-13/h3-6,8,17H,15H2,1-2H3 |
| InChIKey | ORGUDFVOYQNDSI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |